C11H13BO2 — CID 140890983
[4-[(1E)-3-methylbuta-1,3-dienyl]phenyl]boronic acid (PubChem CID 140890983) has the molecular formula C11H13BO2 and a molecular weight of 188.03 g/mol. Its IUPAC name is [4-[(1E)-3-methylbuta-1,3-dienyl]phenyl]boronic acid.
| Compound Name | [4-[(1E)-3-methylbuta-1,3-dienyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 140890983 |
| Molecular Formula | C11H13BO2 |
| Molecular Weight | 188.03 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | [4-[(1E)-3-methylbuta-1,3-dienyl]phenyl]boronic acid |
| SMILES | C=C(C)/C=C/c1ccc(B(O)O)cc1 |
| InChI | InChI=1S/C11H13BO2/c1-9(2)3-4-10-5-7-11(8-6-10)12(13)14/h3-8,13-14H,1H2,2H3/b4-3+ |
| InChIKey | OLEPPKRHJPRQHJ-ONEGZZNKSA-N |
| XLogP | 0.96 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.03 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|