C21H18 — CID 123732172
1-[4-(3-methylbuta-1,3-dienyl)phenyl]naphthalene (PubChem CID 123732172) has the molecular formula C21H18 and a molecular weight of 270.38 g/mol. Its IUPAC name is 1-[4-(3-methylbuta-1,3-dienyl)phenyl]naphthalene.
| Compound Name | 1-[4-(3-methylbuta-1,3-dienyl)phenyl]naphthalene |
|---|---|
| PubChem CID | 123732172 |
| Molecular Formula | C21H18 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 1-[4-(3-methylbuta-1,3-dienyl)phenyl]naphthalene |
| SMILES | C=C(C)C=Cc1ccc(-c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C21H18/c1-16(2)10-11-17-12-14-19(15-13-17)21-9-5-7-18-6-3-4-8-20(18)21/h3-15H,1H2,2H3 |
| InChIKey | SEMKXVOELDBXTE-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|