C19H13F3 — CID 102364058
1-[4-(3,3,3-trifluoroprop-1-en-2-yl)phenyl]naphthalene (PubChem CID 102364058) has the molecular formula C19H13F3 and a molecular weight of 298.31 g/mol. Its IUPAC name is 1-[4-(3,3,3-trifluoroprop-1-en-2-yl)phenyl]naphthalene.
| Compound Name | 1-[4-(3,3,3-trifluoroprop-1-en-2-yl)phenyl]naphthalene |
|---|---|
| PubChem CID | 102364058 |
| Molecular Formula | C19H13F3 |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 1-[4-(3,3,3-trifluoroprop-1-en-2-yl)phenyl]naphthalene |
| SMILES | C=C(c1ccc(-c2cccc3ccccc23)cc1)C(F)(F)F |
| InChI | InChI=1S/C19H13F3/c1-13(19(20,21)22)14-9-11-16(12-10-14)18-8-4-6-15-5-2-3-7-17(15)18/h2-12H,1H2 |
| InChIKey | JSYVYIVHINGMON-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |