C30H28 — CID 145073064
ethane;1-[4-[(3E)-5-phenylhexa-1,3,5-trien-3-yl]phenyl]naphthalene (PubChem CID 145073064) has the molecular formula C30H28 and a molecular weight of 388.55 g/mol. Its IUPAC name is ethane;1-[4-[(3E)-5-phenylhexa-1,3,5-trien-3-yl]phenyl]naphthalene.
| Compound Name | ethane;1-[4-[(3E)-5-phenylhexa-1,3,5-trien-3-yl]phenyl]naphthalene |
|---|---|
| PubChem CID | 145073064 |
| Molecular Formula | C30H28 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | ethane;1-[4-[(3E)-5-phenylhexa-1,3,5-trien-3-yl]phenyl]naphthalene |
| SMILES | C=C/C(=C\C(=C)c1ccccc1)c1ccc(-c2cccc3ccccc23)cc1.CC |
| InChI | InChI=1S/C28H22.C2H6/c1-3-22(20-21(2)23-10-5-4-6-11-23)24-16-18-26(19-17-24)28-15-9-13-25-12-7-8-14-27(25)28;1-2/h3-20H,1-2H2;1-2H3/b22-20+; |
| InChIKey | ZDJMJBATCUWMEB-QPNALZDCSA-N |
| XLogP | 8.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|