C11H12O — CID 121216692
(2Z)-3-phenylpenta-2,4-dien-1-ol (PubChem CID 121216692) has the molecular formula C11H12O and a molecular weight of 160.22 g/mol. Its IUPAC name is (2Z)-3-phenylpenta-2,4-dien-1-ol.
| Compound Name | (2Z)-3-phenylpenta-2,4-dien-1-ol |
|---|---|
| PubChem CID | 121216692 |
| Molecular Formula | C11H12O |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.09 |
| IUPAC Name | (2Z)-3-phenylpenta-2,4-dien-1-ol |
| SMILES | C=C/C(=C/CO)c1ccccc1 |
| InChI | InChI=1S/C11H12O/c1-2-10(8-9-12)11-6-4-3-5-7-11/h2-8,12H,1,9H2/b10-8- |
| InChIKey | ZDYMWRNZONIMGS-NTMALXAHSA-N |
| XLogP | 2.25 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|