C12H14 — CID 175706881
1-deuteriohexa-1,3-dien-3-ylbenzene (PubChem CID 175706881) has the molecular formula C12H14 and a molecular weight of 159.25 g/mol. Its IUPAC name is 1-deuteriohexa-1,3-dien-3-ylbenzene.
| Compound Name | 1-deuteriohexa-1,3-dien-3-ylbenzene |
|---|---|
| PubChem CID | 175706881 |
| Molecular Formula | C12H14 |
| Molecular Weight | 159.25 g/mol |
| Exact Mass | 159.12 |
| IUPAC Name | 1-deuteriohexa-1,3-dien-3-ylbenzene |
| SMILES | [2H]/C=C/C(=CCC)c1ccccc1 |
| InChI | InChI=1S/C12H14/c1-3-8-11(4-2)12-9-6-5-7-10-12/h4-10H,2-3H2,1H3/i2D/b4-2+,11-8? |
| InChIKey | KAVFUGBZIDUJED-VIZPSDQSSA-N |
| XLogP | 3.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.25 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|