About 1-bromobut-1-enylbenzene
1-bromobut-1-enylbenzene (PubChem CID 73187599) has the molecular formula C10H11Br
and a molecular weight of 211.10 g/mol. Its IUPAC name is 1-bromobut-1-enylbenzene.
Molecular Properties
| Compound Name | 1-bromobut-1-enylbenzene |
| PubChem CID | 73187599 |
| Molecular Formula | C10H11Br |
| Molecular Weight | 211.10 g/mol |
| Exact Mass | 210.00 |
| IUPAC Name | 1-bromobut-1-enylbenzene |
| SMILES | CCC=C(Br)c1ccccc1 |
| InChI | InChI=1S/C10H11Br/c1-2-6-10(11)9-7-4-3-5-8-9/h3-8H,2H2,1H3 |
| InChIKey | OBDPBCSRVVJPAP-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.10 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-bromobut-1-enylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromobut-1-enylbenzene?
The IUPAC name of 1-bromobut-1-enylbenzene (CID 73187599) is 1-bromobut-1-enylbenzene.
What is the SMILES notation for 1-bromobut-1-enylbenzene?
The canonical SMILES for 1-bromobut-1-enylbenzene is CCC=C(Br)c1ccccc1.
What is the InChIKey of 1-bromobut-1-enylbenzene?
The InChIKey is OBDPBCSRVVJPAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11Br/c1-2-6-10(11)9-7-4-3-5-8-9/h3-8H,2H2,1H3.
What are the key properties of 1-bromobut-1-enylbenzene?
1-bromobut-1-enylbenzene has a molecular weight of 211.10 g/mol, XLogP of 3.83, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromobut-1-enylbenzene is sourced from PubChem (CID 73187599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).