C12H17N — CID 154209474
N,N-dimethyl-1-phenylbut-1-en-1-amine (PubChem CID 154209474) has the molecular formula C12H17N and a molecular weight of 175.28 g/mol. Its IUPAC name is N,N-dimethyl-1-phenylbut-1-en-1-amine.
| Compound Name | N,N-dimethyl-1-phenylbut-1-en-1-amine |
|---|---|
| PubChem CID | 154209474 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.28 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | N,N-dimethyl-1-phenylbut-1-en-1-amine |
| SMILES | CCC=C(c1ccccc1)N(C)C |
| InChI | InChI=1S/C12H17N/c1-4-8-12(13(2)3)11-9-6-5-7-10-11/h5-10H,4H2,1-3H3 |
| InChIKey | BKTKQFYKPGOKTH-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.28 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |