C25H23NO — CID 13495526
(2Z,4Z)-5-(dimethylamino)-1,3,5-triphenylpenta-2,4-dien-1-one (PubChem CID 13495526) has the molecular formula C25H23NO and a molecular weight of 353.47 g/mol. Its IUPAC name is (2Z,4Z)-5-(dimethylamino)-1,3,5-triphenylpenta-2,4-dien-1-one.
| Compound Name | (2Z,4Z)-5-(dimethylamino)-1,3,5-triphenylpenta-2,4-dien-1-one |
|---|---|
| PubChem CID | 13495526 |
| Molecular Formula | C25H23NO |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | (2Z,4Z)-5-(dimethylamino)-1,3,5-triphenylpenta-2,4-dien-1-one |
| SMILES | CN(C)/C(=C\C(=C\C(=O)c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H23NO/c1-26(2)24(21-14-8-4-9-15-21)18-23(20-12-6-3-7-13-20)19-25(27)22-16-10-5-11-17-22/h3-19H,1-2H3/b23-19-,24-18- |
| InChIKey | FVWGYMFJKBVKJD-VMHIYYNVSA-N |
| XLogP | 5.56 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|