C15H13NO — CID 5376383
(Z)-3-amino-1,3-diphenylprop-2-en-1-one (PubChem CID 5376383) has the molecular formula C15H13NO and a molecular weight of 223.28 g/mol. Its IUPAC name is (Z)-3-amino-1,3-diphenylprop-2-en-1-one.
| Compound Name | (Z)-3-amino-1,3-diphenylprop-2-en-1-one |
|---|---|
| PubChem CID | 5376383 |
| Molecular Formula | C15H13NO |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | (Z)-3-amino-1,3-diphenylprop-2-en-1-one |
| SMILES | N/C(=C\C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H13NO/c16-14(12-7-3-1-4-8-12)11-15(17)13-9-5-2-6-10-13/h1-11H,16H2/b14-11- |
| InChIKey | CDFSTMGURUSUMJ-KAMYIIQDSA-N |
| XLogP | 2.87 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|