C10H8F3NO — CID 5372882
(Z)-4-amino-1,1,1-trifluoro-4-phenylbut-3-en-2-one (PubChem CID 5372882) has the molecular formula C10H8F3NO and a molecular weight of 215.17 g/mol. Its IUPAC name is (Z)-4-amino-1,1,1-trifluoro-4-phenylbut-3-en-2-one.
| Compound Name | (Z)-4-amino-1,1,1-trifluoro-4-phenylbut-3-en-2-one |
|---|---|
| PubChem CID | 5372882 |
| Molecular Formula | C10H8F3NO |
| Molecular Weight | 215.17 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | (Z)-4-amino-1,1,1-trifluoro-4-phenylbut-3-en-2-one |
| SMILES | N/C(=C\C(=O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C10H8F3NO/c11-10(12,13)9(15)6-8(14)7-4-2-1-3-5-7/h1-6H,14H2/b8-6- |
| InChIKey | PRDFATFVFRBFGR-VURMDHGXSA-N |
| XLogP | 2.12 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.17 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|