C10H6F3O2- — CID 14818454
(Z)-4,4,4-trifluoro-3-oxo-1-phenylbut-1-en-1-olate (PubChem CID 14818454) has the molecular formula C10H6F3O2- and a molecular weight of 215.15 g/mol. Its IUPAC name is (Z)-4,4,4-trifluoro-3-oxo-1-phenylbut-1-en-1-olate.
| Compound Name | (Z)-4,4,4-trifluoro-3-oxo-1-phenylbut-1-en-1-olate |
|---|---|
| PubChem CID | 14818454 |
| Molecular Formula | C10H6F3O2- |
| Molecular Weight | 215.15 g/mol |
| Exact Mass | 215.03 |
| IUPAC Name | (Z)-4,4,4-trifluoro-3-oxo-1-phenylbut-1-en-1-olate |
| SMILES | O=C(/C=C(\[O-])c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C10H7F3O2/c11-10(12,13)9(15)6-8(14)7-4-2-1-3-5-7/h1-6,14H/p-1/b8-6- |
| InChIKey | VVRLQETZGSWUNO-VURMDHGXSA-M |
| XLogP | 1.52 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.15 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|