C10H8F2O2 — CID 871908
1,1-difluoro-4-hydroxy-4-phenylbut-3-en-2-one (PubChem CID 871908) has the molecular formula C10H8F2O2 and a molecular weight of 198.17 g/mol. Its IUPAC name is 1,1-difluoro-4-hydroxy-4-phenylbut-3-en-2-one.
| Compound Name | 1,1-difluoro-4-hydroxy-4-phenylbut-3-en-2-one |
|---|---|
| PubChem CID | 871908 |
| Molecular Formula | C10H8F2O2 |
| Molecular Weight | 198.17 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | 1,1-difluoro-4-hydroxy-4-phenylbut-3-en-2-one |
| SMILES | O=C(C=C(O)c1ccccc1)C(F)F |
| InChI | InChI=1S/C10H8F2O2/c11-10(12)9(14)6-8(13)7-4-2-1-3-5-7/h1-6,10,13H |
| InChIKey | MPBVZXNPAMVEBX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.17 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|