C30H24O2 — CID 175049722
4-hydroxy-4-[4-(1,2,2-triphenylethenyl)phenyl]but-3-en-2-one (PubChem CID 175049722) has the molecular formula C30H24O2 and a molecular weight of 416.52 g/mol. Its IUPAC name is 4-hydroxy-4-[4-(1,2,2-triphenylethenyl)phenyl]but-3-en-2-one.
| Compound Name | 4-hydroxy-4-[4-(1,2,2-triphenylethenyl)phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 175049722 |
| Molecular Formula | C30H24O2 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 4-hydroxy-4-[4-(1,2,2-triphenylethenyl)phenyl]but-3-en-2-one |
| SMILES | CC(=O)C=C(O)c1ccc(C(=C(c2ccccc2)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H24O2/c1-22(31)21-28(32)23-17-19-27(20-18-23)30(26-15-9-4-10-16-26)29(24-11-5-2-6-12-24)25-13-7-3-8-14-25/h2-21,32H,1H3 |
| InChIKey | VXOAJBNKCFISQF-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|