About 4,4-diphenylbut-3-en-2-one;hydrazine
4,4-diphenylbut-3-en-2-one;hydrazine (PubChem CID 158754130) has the molecular formula C16H18N2O
and a molecular weight of 254.33 g/mol. Its IUPAC name is 4,4-diphenylbut-3-en-2-one;hydrazine.
Molecular Properties
| Compound Name | 4,4-diphenylbut-3-en-2-one;hydrazine |
| PubChem CID | 158754130 |
| Molecular Formula | C16H18N2O |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 4,4-diphenylbut-3-en-2-one;hydrazine |
| SMILES | CC(=O)C=C(c1ccccc1)c1ccccc1.NN |
| InChI | InChI=1S/C16H14O.H4N2/c1-13(17)12-16(14-8-4-2-5-9-14)15-10-6-3-7-11-15;1-2/h2-12H,1H3;1-2H2 |
| InChIKey | INVSLPHYHVZCQL-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4,4-diphenylbut-3-en-2-one;hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-diphenylbut-3-en-2-one;hydrazine?
The IUPAC name of 4,4-diphenylbut-3-en-2-one;hydrazine (CID 158754130) is 4,4-diphenylbut-3-en-2-one;hydrazine.
What is the SMILES notation for 4,4-diphenylbut-3-en-2-one;hydrazine?
The canonical SMILES for 4,4-diphenylbut-3-en-2-one;hydrazine is CC(=O)C=C(c1ccccc1)c1ccccc1.NN.
What is the InChIKey of 4,4-diphenylbut-3-en-2-one;hydrazine?
The InChIKey is INVSLPHYHVZCQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O.H4N2/c1-13(17)12-16(14-8-4-2-5-9-14)15-10-6-3-7-11-15;1-2/h2-12H,1H3;1-2H2.
What are the key properties of 4,4-diphenylbut-3-en-2-one;hydrazine?
4,4-diphenylbut-3-en-2-one;hydrazine has a molecular weight of 254.33 g/mol, XLogP of 2.53, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-diphenylbut-3-en-2-one;hydrazine is sourced from PubChem (CID 158754130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).