About bis(iron(2+));(Z)-4-oxopent-2-en-2-olate;benzoate
bis(iron(2+));(Z)-4-oxopent-2-en-2-olate;benzoate (PubChem CID 23332500) has the molecular formula C12H12Fe2O4+2
and a molecular weight of 331.91 g/mol. Its IUPAC name is bis(iron(2+));(Z)-4-oxopent-2-en-2-olate;benzoate.
Molecular Properties
| Compound Name | bis(iron(2+));(Z)-4-oxopent-2-en-2-olate;benzoate |
| PubChem CID | 23332500 |
| Molecular Formula | C12H12Fe2O4+2 |
| Molecular Weight | 331.91 g/mol |
| Exact Mass | 331.94 |
| IUPAC Name | bis(iron(2+));(Z)-4-oxopent-2-en-2-olate;benzoate |
| SMILES | CC(=O)/C=C(/C)[O-].O=C([O-])c1ccccc1.[Fe+2].[Fe+2] |
| InChI | InChI=1S/C7H6O2.C5H8O2.2Fe/c8-7(9)6-4-2-1-3-5-6;1-4(6)3-5(2)7;;/h1-5H,(H,8,9);3,6H,1-2H3;;/q;;2*+2/p-2/b;4-3-;; |
| InChIKey | KFYYRPYNGIMKFM-MECAPONASA-L |
| XLogP | -0.12 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.91 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze bis(iron(2+));(Z)-4-oxopent-2-en-2-olate;benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(iron(2+));(Z)-4-oxopent-2-en-2-olate;benzoate?
The IUPAC name of bis(iron(2+));(Z)-4-oxopent-2-en-2-olate;benzoate (CID 23332500) is bis(iron(2+));(Z)-4-oxopent-2-en-2-olate;benzoate.
What is the SMILES notation for bis(iron(2+));(Z)-4-oxopent-2-en-2-olate;benzoate?
The canonical SMILES for bis(iron(2+));(Z)-4-oxopent-2-en-2-olate;benzoate is CC(=O)/C=C(/C)[O-].O=C([O-])c1ccccc1.[Fe+2].[Fe+2].
What is the InChIKey of bis(iron(2+));(Z)-4-oxopent-2-en-2-olate;benzoate?
The InChIKey is KFYYRPYNGIMKFM-MECAPONASA-L. The full InChI is InChI=1S/C7H6O2.C5H8O2.2Fe/c8-7(9)6-4-2-1-3-5-6;1-4(6)3-5(2)7;;/h1-5H,(H,8,9);3,6H,1-2H3;;/q;;2*+2/p-2/b;4-3-;;.
What are the key properties of bis(iron(2+));(Z)-4-oxopent-2-en-2-olate;benzoate?
bis(iron(2+));(Z)-4-oxopent-2-en-2-olate;benzoate has a molecular weight of 331.91 g/mol, XLogP of -0.12, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(iron(2+));(Z)-4-oxopent-2-en-2-olate;benzoate is sourced from PubChem (CID 23332500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).