About 4,4-diphenylbut-3-en-2-one;ethane;propan-2-one
4,4-diphenylbut-3-en-2-one;ethane;propan-2-one (PubChem CID 91332557) has the molecular formula C25H38O2
and a molecular weight of 370.58 g/mol. Its IUPAC name is 4,4-diphenylbut-3-en-2-one;ethane;propan-2-one.
Molecular Properties
| Compound Name | 4,4-diphenylbut-3-en-2-one;ethane;propan-2-one |
| PubChem CID | 91332557 |
| Molecular Formula | C25H38O2 |
| Molecular Weight | 370.58 g/mol |
| Exact Mass | 370.29 |
| IUPAC Name | 4,4-diphenylbut-3-en-2-one;ethane;propan-2-one |
| SMILES | CC.CC.CC.CC(=O)C=C(c1ccccc1)c1ccccc1.CC(C)=O |
| InChI | InChI=1S/C16H14O.C3H6O.3C2H6/c1-13(17)12-16(14-8-4-2-5-9-14)15-10-6-3-7-11-15;1-3(2)4;3*1-2/h2-12H,1H3;1-2H3;3*1-2H3 |
| InChIKey | OYXLMXTUZLAKIU-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.58 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4,4-diphenylbut-3-en-2-one;ethane;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-diphenylbut-3-en-2-one;ethane;propan-2-one?
The IUPAC name of 4,4-diphenylbut-3-en-2-one;ethane;propan-2-one (CID 91332557) is 4,4-diphenylbut-3-en-2-one;ethane;propan-2-one.
What is the SMILES notation for 4,4-diphenylbut-3-en-2-one;ethane;propan-2-one?
The canonical SMILES for 4,4-diphenylbut-3-en-2-one;ethane;propan-2-one is CC.CC.CC.CC(=O)C=C(c1ccccc1)c1ccccc1.CC(C)=O.
What is the InChIKey of 4,4-diphenylbut-3-en-2-one;ethane;propan-2-one?
The InChIKey is OYXLMXTUZLAKIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O.C3H6O.3C2H6/c1-13(17)12-16(14-8-4-2-5-9-14)15-10-6-3-7-11-15;1-3(2)4;3*1-2/h2-12H,1H3;1-2H3;3*1-2H3.
What are the key properties of 4,4-diphenylbut-3-en-2-one;ethane;propan-2-one?
4,4-diphenylbut-3-en-2-one;ethane;propan-2-one has a molecular weight of 370.58 g/mol, XLogP of 7.38, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-diphenylbut-3-en-2-one;ethane;propan-2-one is sourced from PubChem (CID 91332557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).