C30H24O4Zn — CID 5369713
bis((Z)-3-hydroxy-1,3-diphenylprop-2-en-1-one);zinc (PubChem CID 5369713) has the molecular formula C30H24O4Zn and a molecular weight of 513.91 g/mol. Its IUPAC name is bis((Z)-3-hydroxy-1,3-diphenylprop-2-en-1-one);zinc.
| Compound Name | bis((Z)-3-hydroxy-1,3-diphenylprop-2-en-1-one);zinc |
|---|---|
| PubChem CID | 5369713 |
| Molecular Formula | C30H24O4Zn |
| Molecular Weight | 513.91 g/mol |
| Exact Mass | 512.10 |
| IUPAC Name | bis((Z)-3-hydroxy-1,3-diphenylprop-2-en-1-one);zinc |
| SMILES | O=C(/C=C(\O)c1ccccc1)c1ccccc1.O=C(/C=C(\O)c1ccccc1)c1ccccc1.[Zn] |
| InChI | InChI=1S/2C15H12O2.Zn/c2*16-14(12-7-3-1-4-8-12)11-15(17)13-9-5-2-6-10-13;/h2*1-11,16H;/b2*14-11-; |
| InChIKey | SUARMEZLWZKBLT-AGIYBIRKSA-N |
| XLogP | 6.93 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.91 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|