C15H16N2O2+2 — CID 101012654
3-hydroxy-1,3-bis(1-methylpyridin-1-ium-4-yl)prop-2-en-1-one (PubChem CID 101012654) has the molecular formula C15H16N2O2+2 and a molecular weight of 256.31 g/mol. Its IUPAC name is 3-hydroxy-1,3-bis(1-methylpyridin-1-ium-4-yl)prop-2-en-1-one.
| Compound Name | 3-hydroxy-1,3-bis(1-methylpyridin-1-ium-4-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 101012654 |
| Molecular Formula | C15H16N2O2+2 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 3-hydroxy-1,3-bis(1-methylpyridin-1-ium-4-yl)prop-2-en-1-one |
| SMILES | C[n+]1ccc(C(=O)C=C(O)c2cc[n+](C)cc2)cc1 |
| InChI | InChI=1S/C15H15N2O2/c1-16-7-3-12(4-8-16)14(18)11-15(19)13-5-9-17(2)10-6-13/h3-11H,1-2H3/q+1/p+1 |
| InChIKey | GLMWKDONCBBLDY-UHFFFAOYSA-O |
| XLogP | 1.12 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|