C15H11ClO — CID 12890118
(Z)-3-chloro-1,3-diphenylprop-2-en-1-one (PubChem CID 12890118) has the molecular formula C15H11ClO and a molecular weight of 242.71 g/mol. Its IUPAC name is (Z)-3-chloro-1,3-diphenylprop-2-en-1-one.
| Compound Name | (Z)-3-chloro-1,3-diphenylprop-2-en-1-one |
|---|---|
| PubChem CID | 12890118 |
| Molecular Formula | C15H11ClO |
| Molecular Weight | 242.71 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | (Z)-3-chloro-1,3-diphenylprop-2-en-1-one |
| SMILES | O=C(/C=C(\Cl)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H11ClO/c16-14(12-7-3-1-4-8-12)11-15(17)13-9-5-2-6-10-13/h1-11H/b14-11- |
| InChIKey | FQEBYFDFKICMDS-KAMYIIQDSA-N |
| XLogP | 4.15 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.71 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|