C22H16O2 — CID 5369696
(Z)-1,2,4-triphenylbut-2-ene-1,4-dione (PubChem CID 5369696) has the molecular formula C22H16O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is (Z)-1,2,4-triphenylbut-2-ene-1,4-dione.
| Compound Name | (Z)-1,2,4-triphenylbut-2-ene-1,4-dione |
|---|---|
| PubChem CID | 5369696 |
| Molecular Formula | C22H16O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | (Z)-1,2,4-triphenylbut-2-ene-1,4-dione |
| SMILES | O=C(/C=C(\C(=O)c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H16O2/c23-21(18-12-6-2-7-13-18)16-20(17-10-4-1-5-11-17)22(24)19-14-8-3-9-15-19/h1-16H/b20-16- |
| InChIKey | MEBZZSFHCRISAQ-SILNSSARSA-N |
| XLogP | 4.84 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|