C46H34O2 — CID 139037325
(2Z,4Z,6Z,8Z)-1,3,4,7,8,10-hexakis-phenyldeca-2,4,6,8-tetraene-1,10-dione (PubChem CID 139037325) has the molecular formula C46H34O2 and a molecular weight of 618.78 g/mol. Its IUPAC name is (2Z,4Z,6Z,8Z)-1,3,4,7,8,10-hexakis-phenyldeca-2,4,6,8-tetraene-1,10-dione.
| Compound Name | (2Z,4Z,6Z,8Z)-1,3,4,7,8,10-hexakis-phenyldeca-2,4,6,8-tetraene-1,10-dione |
|---|---|
| PubChem CID | 139037325 |
| Molecular Formula | C46H34O2 |
| Molecular Weight | 618.78 g/mol |
| Exact Mass | 618.26 |
| IUPAC Name | (2Z,4Z,6Z,8Z)-1,3,4,7,8,10-hexakis-phenyldeca-2,4,6,8-tetraene-1,10-dione |
| SMILES | O=C(/C=C(C(=C/C=C(C(=C/C(=O)c1ccccc1)\c1ccccc1)/c1ccccc1)\c1ccccc1)/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C46H34O2/c47-45(39-27-15-5-16-28-39)33-43(37-23-11-3-12-24-37)41(35-19-7-1-8-20-35)31-32-42(36-21-9-2-10-22-36)44(38-25-13-4-14-26-38)34-46(48)40-29-17-6-18-30-40/h1-34H/b41-31-,42-32-,43-33-,44-34- |
| InChIKey | MHLZKFZDVZYFRI-ZEHKMYHASA-N |
| XLogP | 11.09 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.78 |
| LogP ≤ 5 | 11.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|