About CID 50937319
CID 50937319 (PubChem CID 50937319) has the molecular formula C18H20O2Sn-4
and a molecular weight of 387.07 g/mol.
Molecular Properties
| Compound Name | CID 50937319 |
| PubChem CID | 50937319 |
| Molecular Formula | C18H20O2Sn-4 |
| Molecular Weight | 387.07 g/mol |
| Exact Mass | 388.05 |
| IUPAC Name | — |
| SMILES | O=C(/C=C(\[O-])c1ccccc1)c1ccccc1.[CH3-].[CH3-].[CH3-].[Sn] |
| InChI | InChI=1S/C15H12O2.3CH3.Sn/c16-14(12-7-3-1-4-8-12)11-15(17)13-9-5-2-6-10-13;;;;/h1-11,16H;3*1H3;/q;3*-1;/p-1/b14-11-;;;; |
| InChIKey | KQDSWMPTVAVYHK-VDOWVRHSSA-M |
| XLogP | 3.24 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.07 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 50937319 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 50937319?
The IUPAC name of CID 50937319 (CID 50937319) is not available.
What is the SMILES notation for CID 50937319?
The canonical SMILES for CID 50937319 is O=C(/C=C(\[O-])c1ccccc1)c1ccccc1.[CH3-].[CH3-].[CH3-].[Sn].
What is the InChIKey of CID 50937319?
The InChIKey is KQDSWMPTVAVYHK-VDOWVRHSSA-M. The full InChI is InChI=1S/C15H12O2.3CH3.Sn/c16-14(12-7-3-1-4-8-12)11-15(17)13-9-5-2-6-10-13;;;;/h1-11,16H;3*1H3;/q;3*-1;/p-1/b14-11-;;;;.
What are the key properties of CID 50937319?
CID 50937319 has a molecular weight of 387.07 g/mol, XLogP of 3.24, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 50937319 is sourced from PubChem (CID 50937319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).