About phenacylidenetungsten
phenacylidenetungsten (PubChem CID 139264471) has the molecular formula C8H6OW
and a molecular weight of 301.98 g/mol. Its IUPAC name is phenacylidenetungsten.
Molecular Properties
| Compound Name | phenacylidenetungsten |
| PubChem CID | 139264471 |
| Molecular Formula | C8H6OW |
| Molecular Weight | 301.98 g/mol |
| Exact Mass | 301.99 |
| IUPAC Name | phenacylidenetungsten |
| SMILES | O=C(C=[W])c1ccccc1 |
| InChI | InChI=1S/C8H6O.W/c1-7(9)8-5-3-2-4-6-8;/h1-6H; |
| InChIKey | PZJILTNYNYIOHE-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.98 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze phenacylidenetungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenacylidenetungsten?
The IUPAC name of phenacylidenetungsten (CID 139264471) is phenacylidenetungsten.
What is the SMILES notation for phenacylidenetungsten?
The canonical SMILES for phenacylidenetungsten is O=C(C=[W])c1ccccc1.
What is the InChIKey of phenacylidenetungsten?
The InChIKey is PZJILTNYNYIOHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O.W/c1-7(9)8-5-3-2-4-6-8;/h1-6H;.
What are the key properties of phenacylidenetungsten?
phenacylidenetungsten has a molecular weight of 301.98 g/mol, XLogP of 1.22, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for phenacylidenetungsten is sourced from PubChem (CID 139264471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).