About carbon monoxide;(Z)-3-hydroxy-1-phenylbut-2-en-1-one;rhodium
carbon monoxide;(Z)-3-hydroxy-1-phenylbut-2-en-1-one;rhodium (PubChem CID 135473696) has the molecular formula C12H10O4Rh
and a molecular weight of 321.11 g/mol. Its IUPAC name is carbon monoxide;(Z)-3-hydroxy-1-phenylbut-2-en-1-one;rhodium.
Molecular Properties
| Compound Name | carbon monoxide;(Z)-3-hydroxy-1-phenylbut-2-en-1-one;rhodium |
| PubChem CID | 135473696 |
| Molecular Formula | C12H10O4Rh |
| Molecular Weight | 321.11 g/mol |
| Exact Mass | 320.96 |
| IUPAC Name | carbon monoxide;(Z)-3-hydroxy-1-phenylbut-2-en-1-one;rhodium |
| SMILES | C/C(O)=C/C(=O)c1ccccc1.[C-]#[O+].[C-]#[O+].[Rh] |
| InChI | InChI=1S/C10H10O2.2CO.Rh/c1-8(11)7-10(12)9-5-3-2-4-6-9;2*1-2;/h2-7,11H,1H3;;;/b8-7-;;; |
| InChIKey | BHAHPYGNTXHCSR-IRYVOTIRSA-N |
| XLogP | 2.25 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.11 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze carbon monoxide;(Z)-3-hydroxy-1-phenylbut-2-en-1-one;rhodium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon monoxide;(Z)-3-hydroxy-1-phenylbut-2-en-1-one;rhodium?
The IUPAC name of carbon monoxide;(Z)-3-hydroxy-1-phenylbut-2-en-1-one;rhodium (CID 135473696) is carbon monoxide;(Z)-3-hydroxy-1-phenylbut-2-en-1-one;rhodium.
What is the SMILES notation for carbon monoxide;(Z)-3-hydroxy-1-phenylbut-2-en-1-one;rhodium?
The canonical SMILES for carbon monoxide;(Z)-3-hydroxy-1-phenylbut-2-en-1-one;rhodium is C/C(O)=C/C(=O)c1ccccc1.[C-]#[O+].[C-]#[O+].[Rh].
What is the InChIKey of carbon monoxide;(Z)-3-hydroxy-1-phenylbut-2-en-1-one;rhodium?
The InChIKey is BHAHPYGNTXHCSR-IRYVOTIRSA-N. The full InChI is InChI=1S/C10H10O2.2CO.Rh/c1-8(11)7-10(12)9-5-3-2-4-6-9;2*1-2;/h2-7,11H,1H3;;;/b8-7-;;;.
What are the key properties of carbon monoxide;(Z)-3-hydroxy-1-phenylbut-2-en-1-one;rhodium?
carbon monoxide;(Z)-3-hydroxy-1-phenylbut-2-en-1-one;rhodium has a molecular weight of 321.11 g/mol, XLogP of 2.25, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbon monoxide;(Z)-3-hydroxy-1-phenylbut-2-en-1-one;rhodium is sourced from PubChem (CID 135473696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).