C15H14NNaO — CID 173426238
sodium;3-amino-1,3-diphenylprop-2-en-1-one;hydride (PubChem CID 173426238) has the molecular formula C15H14NNaO and a molecular weight of 247.27 g/mol. Its IUPAC name is sodium;3-amino-1,3-diphenylprop-2-en-1-one;hydride.
| Compound Name | sodium;3-amino-1,3-diphenylprop-2-en-1-one;hydride |
|---|---|
| PubChem CID | 173426238 |
| Molecular Formula | C15H14NNaO |
| Molecular Weight | 247.27 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | sodium;3-amino-1,3-diphenylprop-2-en-1-one;hydride |
| SMILES | NC(=CC(=O)c1ccccc1)c1ccccc1.[H-].[Na+] |
| InChI | InChI=1S/C15H13NO.Na.H/c16-14(12-7-3-1-4-8-12)11-15(17)13-9-5-2-6-10-13;;/h1-11H,16H2;;/q;+1;-1 |
| InChIKey | DDIZBVGHIUKYSJ-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.27 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|