C13H9ClN2O3 — CID 20835139
5-[(E)-1-chloro-3-oxo-3-phenylprop-1-enyl]-1H-pyrimidine-2,4-dione (PubChem CID 20835139) has the molecular formula C13H9ClN2O3 and a molecular weight of 276.68 g/mol. Its IUPAC name is 5-[(E)-1-chloro-3-oxo-3-phenylprop-1-enyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 5-[(E)-1-chloro-3-oxo-3-phenylprop-1-enyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 20835139 |
| Molecular Formula | C13H9ClN2O3 |
| Molecular Weight | 276.68 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | 5-[(E)-1-chloro-3-oxo-3-phenylprop-1-enyl]-1H-pyrimidine-2,4-dione |
| SMILES | O=C(/C=C(/Cl)c1c[nH]c(=O)[nH]c1=O)c1ccccc1 |
| InChI | InChI=1S/C13H9ClN2O3/c14-10(9-7-15-13(19)16-12(9)18)6-11(17)8-4-2-1-3-5-8/h1-7H,(H2,15,16,18,19)/b10-6+ |
| InChIKey | CIGSDLUEGYCADR-UXBLZVDNSA-N |
| XLogP | 1.53 |
| TPSA | 82.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.68 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|