About lithium;2,4-dioxo-1H-pyrimidine-5-carboxylate;hydrate
lithium;2,4-dioxo-1H-pyrimidine-5-carboxylate;hydrate (PubChem CID 139189490) has the molecular formula C5H5LiN2O5
and a molecular weight of 180.04 g/mol. Its IUPAC name is lithium;2,4-dioxo-1H-pyrimidine-5-carboxylate;hydrate.
Molecular Properties
| Compound Name | lithium;2,4-dioxo-1H-pyrimidine-5-carboxylate;hydrate |
| PubChem CID | 139189490 |
| Molecular Formula | C5H5LiN2O5 |
| Molecular Weight | 180.04 g/mol |
| Exact Mass | 180.04 |
| IUPAC Name | lithium;2,4-dioxo-1H-pyrimidine-5-carboxylate;hydrate |
| SMILES | O.O=C([O-])c1c[nH]c(=O)[nH]c1=O.[Li+] |
| InChI | InChI=1S/C5H4N2O4.Li.H2O/c8-3-2(4(9)10)1-6-5(11)7-3;;/h1H,(H,9,10)(H2,6,7,8,11);;1H2/q;+1;/p-1 |
| InChIKey | FMOWRGHQUHKVFK-UHFFFAOYSA-M |
| XLogP | -6.39 |
| TPSA | 137.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.04 |
| LogP ≤ 5 | -6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze lithium;2,4-dioxo-1H-pyrimidine-5-carboxylate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;2,4-dioxo-1H-pyrimidine-5-carboxylate;hydrate?
The IUPAC name of lithium;2,4-dioxo-1H-pyrimidine-5-carboxylate;hydrate (CID 139189490) is lithium;2,4-dioxo-1H-pyrimidine-5-carboxylate;hydrate.
What is the SMILES notation for lithium;2,4-dioxo-1H-pyrimidine-5-carboxylate;hydrate?
The canonical SMILES for lithium;2,4-dioxo-1H-pyrimidine-5-carboxylate;hydrate is O.O=C([O-])c1c[nH]c(=O)[nH]c1=O.[Li+].
What is the InChIKey of lithium;2,4-dioxo-1H-pyrimidine-5-carboxylate;hydrate?
The InChIKey is FMOWRGHQUHKVFK-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H4N2O4.Li.H2O/c8-3-2(4(9)10)1-6-5(11)7-3;;/h1H,(H,9,10)(H2,6,7,8,11);;1H2/q;+1;/p-1.
What are the key properties of lithium;2,4-dioxo-1H-pyrimidine-5-carboxylate;hydrate?
lithium;2,4-dioxo-1H-pyrimidine-5-carboxylate;hydrate has a molecular weight of 180.04 g/mol, XLogP of -6.39, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;2,4-dioxo-1H-pyrimidine-5-carboxylate;hydrate is sourced from PubChem (CID 139189490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).