hydroxymethyl 2,4-dioxo-1H-pyrimidine-5-carboxylate

C6H6N2O5 — CID 141245679

IUPAChydroxymethyl 2,4-dioxo-1H-pyrimidine-5-carboxylate
SMILESO=C(OCO)c1c[nH]c(=O)[nH]c1=O
InChIInChI=1S/C6H6N2O5/c9-2-13-5(11)3-1-7-6(12)8-4(3)10/h1,9H,2H2,(H2,7,8,10,12)
InChIKeySFQZXOPQJNAXAS-UHFFFAOYSA-N
MW186.12 g/mol
LogP-1.83
Rot. Bonds2

About hydroxymethyl 2,4-dioxo-1H-pyrimidine-5-carboxylate

hydroxymethyl 2,4-dioxo-1H-pyrimidine-5-carboxylate (PubChem CID 141245679) has the molecular formula C6H6N2O5 and a molecular weight of 186.12 g/mol. Its IUPAC name is hydroxymethyl 2,4-dioxo-1H-pyrimidine-5-carboxylate.

Molecular Properties

Compound Namehydroxymethyl 2,4-dioxo-1H-pyrimidine-5-carboxylate
PubChem CID141245679
Molecular FormulaC6H6N2O5
Molecular Weight186.12 g/mol
Exact Mass186.03
IUPAC Namehydroxymethyl 2,4-dioxo-1H-pyrimidine-5-carboxylate
SMILESO=C(OCO)c1c[nH]c(=O)[nH]c1=O
InChIInChI=1S/C6H6N2O5/c9-2-13-5(11)3-1-7-6(12)8-4(3)10/h1,9H,2H2,(H2,7,8,10,12)
InChIKeySFQZXOPQJNAXAS-UHFFFAOYSA-N
XLogP-1.83
TPSA112.25 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500186.12
LogP ≤ 5-1.83
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}

Analyze hydroxymethyl 2,4-dioxo-1H-pyrimidine-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of hydroxymethyl 2,4-dioxo-1H-pyrimidine-5-carboxylate?
The IUPAC name of hydroxymethyl 2,4-dioxo-1H-pyrimidine-5-carboxylate (CID 141245679) is hydroxymethyl 2,4-dioxo-1H-pyrimidine-5-carboxylate.
What is the SMILES notation for hydroxymethyl 2,4-dioxo-1H-pyrimidine-5-carboxylate?
The canonical SMILES for hydroxymethyl 2,4-dioxo-1H-pyrimidine-5-carboxylate is O=C(OCO)c1c[nH]c(=O)[nH]c1=O.
What is the InChIKey of hydroxymethyl 2,4-dioxo-1H-pyrimidine-5-carboxylate?
The InChIKey is SFQZXOPQJNAXAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O5/c9-2-13-5(11)3-1-7-6(12)8-4(3)10/h1,9H,2H2,(H2,7,8,10,12).
What are the key properties of hydroxymethyl 2,4-dioxo-1H-pyrimidine-5-carboxylate?
hydroxymethyl 2,4-dioxo-1H-pyrimidine-5-carboxylate has a molecular weight of 186.12 g/mol, XLogP of -1.83, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxymethyl 2,4-dioxo-1H-pyrimidine-5-carboxylate is sourced from PubChem (CID 141245679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).