C6H6N2O5 — CID 141245679
hydroxymethyl 2,4-dioxo-1H-pyrimidine-5-carboxylate (PubChem CID 141245679) has the molecular formula C6H6N2O5 and a molecular weight of 186.12 g/mol. Its IUPAC name is hydroxymethyl 2,4-dioxo-1H-pyrimidine-5-carboxylate.
| Compound Name | hydroxymethyl 2,4-dioxo-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 141245679 |
| Molecular Formula | C6H6N2O5 |
| Molecular Weight | 186.12 g/mol |
| Exact Mass | 186.03 |
| IUPAC Name | hydroxymethyl 2,4-dioxo-1H-pyrimidine-5-carboxylate |
| SMILES | O=C(OCO)c1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C6H6N2O5/c9-2-13-5(11)3-1-7-6(12)8-4(3)10/h1,9H,2H2,(H2,7,8,10,12) |
| InChIKey | SFQZXOPQJNAXAS-UHFFFAOYSA-N |
| XLogP | -1.83 |
| TPSA | 112.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.12 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|