C5H3IN2O3 — CID 135171307
2,4-dioxo-1H-pyrimidine-5-carbonyl iodide (PubChem CID 135171307) has the molecular formula C5H3IN2O3 and a molecular weight of 265.99 g/mol. Its IUPAC name is 2,4-dioxo-1H-pyrimidine-5-carbonyl iodide.
| Compound Name | 2,4-dioxo-1H-pyrimidine-5-carbonyl iodide |
|---|---|
| PubChem CID | 135171307 |
| Molecular Formula | C5H3IN2O3 |
| Molecular Weight | 265.99 g/mol |
| Exact Mass | 265.92 |
| IUPAC Name | 2,4-dioxo-1H-pyrimidine-5-carbonyl iodide |
| SMILES | O=C(I)c1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C5H3IN2O3/c6-3(9)2-1-7-5(11)8-4(2)10/h1H,(H2,7,8,10,11) |
| InChIKey | POPWNIONKCQHMI-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 82.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.99 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|