C5H4AgN2O3S — CID 162262036
2,4-dioxo-1H-pyrimidine-5-carbothioic S-acid;silver (PubChem CID 162262036) has the molecular formula C5H4AgN2O3S and a molecular weight of 280.03 g/mol. Its IUPAC name is 2,4-dioxo-1H-pyrimidine-5-carbothioic S-acid;silver.
| Compound Name | 2,4-dioxo-1H-pyrimidine-5-carbothioic S-acid;silver |
|---|---|
| PubChem CID | 162262036 |
| Molecular Formula | C5H4AgN2O3S |
| Molecular Weight | 280.03 g/mol |
| Exact Mass | 278.90 |
| IUPAC Name | 2,4-dioxo-1H-pyrimidine-5-carbothioic S-acid;silver |
| SMILES | O=C(S)c1c[nH]c(=O)[nH]c1=O.[Ag] |
| InChI | InChI=1S/C5H4N2O3S.Ag/c8-3-2(4(9)11)1-6-5(10)7-3;/h1H,(H,9,11)(H2,6,7,8,10); |
| InChIKey | ZZJOUCJPGRPTID-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 82.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.03 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|