2,4-dioxo-1H-pyrimidine-5-carbothioic S-acid;silver

C5H4AgN2O3S — CID 162262036

IUPAC2,4-dioxo-1H-pyrimidine-5-carbothioic S-acid;silver
SMILESO=C(S)c1c[nH]c(=O)[nH]c1=O.[Ag]
InChIInChI=1S/C5H4N2O3S.Ag/c8-3-2(4(9)11)1-6-5(10)7-3;/h1H,(H,9,11)(H2,6,7,8,10);
InChIKeyZZJOUCJPGRPTID-UHFFFAOYSA-N
MW280.03 g/mol
LogP-0.87
Rot. Bonds1

About 2,4-dioxo-1H-pyrimidine-5-carbothioic S-acid;silver

2,4-dioxo-1H-pyrimidine-5-carbothioic S-acid;silver (PubChem CID 162262036) has the molecular formula C5H4AgN2O3S and a molecular weight of 280.03 g/mol. Its IUPAC name is 2,4-dioxo-1H-pyrimidine-5-carbothioic S-acid;silver.

Molecular Properties

Compound Name2,4-dioxo-1H-pyrimidine-5-carbothioic S-acid;silver
PubChem CID162262036
Molecular FormulaC5H4AgN2O3S
Molecular Weight280.03 g/mol
Exact Mass278.90
IUPAC Name2,4-dioxo-1H-pyrimidine-5-carbothioic S-acid;silver
SMILESO=C(S)c1c[nH]c(=O)[nH]c1=O.[Ag]
InChIInChI=1S/C5H4N2O3S.Ag/c8-3-2(4(9)11)1-6-5(10)7-3;/h1H,(H,9,11)(H2,6,7,8,10);
InChIKeyZZJOUCJPGRPTID-UHFFFAOYSA-N
XLogP-0.87
TPSA82.79 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500280.03
LogP ≤ 5-0.87
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}

Analyze 2,4-dioxo-1H-pyrimidine-5-carbothioic S-acid;silver with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,4-dioxo-1H-pyrimidine-5-carbothioic S-acid;silver?
The IUPAC name of 2,4-dioxo-1H-pyrimidine-5-carbothioic S-acid;silver (CID 162262036) is 2,4-dioxo-1H-pyrimidine-5-carbothioic S-acid;silver.
What is the SMILES notation for 2,4-dioxo-1H-pyrimidine-5-carbothioic S-acid;silver?
The canonical SMILES for 2,4-dioxo-1H-pyrimidine-5-carbothioic S-acid;silver is O=C(S)c1c[nH]c(=O)[nH]c1=O.[Ag].
What is the InChIKey of 2,4-dioxo-1H-pyrimidine-5-carbothioic S-acid;silver?
The InChIKey is ZZJOUCJPGRPTID-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N2O3S.Ag/c8-3-2(4(9)11)1-6-5(10)7-3;/h1H,(H,9,11)(H2,6,7,8,10);.
What are the key properties of 2,4-dioxo-1H-pyrimidine-5-carbothioic S-acid;silver?
2,4-dioxo-1H-pyrimidine-5-carbothioic S-acid;silver has a molecular weight of 280.03 g/mol, XLogP of -0.87, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dioxo-1H-pyrimidine-5-carbothioic S-acid;silver is sourced from PubChem (CID 162262036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).