C4H6N2O4 — CID 175729684
5-hydroxy-1H-pyrimidine-2,4-dione;hydrate (PubChem CID 175729684) has the molecular formula C4H6N2O4 and a molecular weight of 146.10 g/mol. Its IUPAC name is 5-hydroxy-1H-pyrimidine-2,4-dione;hydrate.
| Compound Name | 5-hydroxy-1H-pyrimidine-2,4-dione;hydrate |
|---|---|
| PubChem CID | 175729684 |
| Molecular Formula | C4H6N2O4 |
| Molecular Weight | 146.10 g/mol |
| Exact Mass | 146.03 |
| IUPAC Name | 5-hydroxy-1H-pyrimidine-2,4-dione;hydrate |
| SMILES | O.O=c1[nH]cc(O)c(=O)[nH]1 |
| InChI | InChI=1S/C4H4N2O3.H2O/c7-2-1-5-4(9)6-3(2)8;/h1,7H,(H2,5,6,8,9);1H2 |
| InChIKey | RPKJBRKDMTZTFO-UHFFFAOYSA-N |
| XLogP | -2.06 |
| TPSA | 117.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.10 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |