C4H8AlFN2O3 — CID 174923664
alumane;5-fluoro-1H-pyrimidine-2,4-dione;hydrate (PubChem CID 174923664) has the molecular formula C4H8AlFN2O3 and a molecular weight of 178.10 g/mol. Its IUPAC name is alumane;5-fluoro-1H-pyrimidine-2,4-dione;hydrate.
| Compound Name | alumane;5-fluoro-1H-pyrimidine-2,4-dione;hydrate |
|---|---|
| PubChem CID | 174923664 |
| Molecular Formula | C4H8AlFN2O3 |
| Molecular Weight | 178.10 g/mol |
| Exact Mass | 178.03 |
| IUPAC Name | alumane;5-fluoro-1H-pyrimidine-2,4-dione;hydrate |
| SMILES | O.O=c1[nH]cc(F)c(=O)[nH]1.[AlH3] |
| InChI | InChI=1S/C4H3FN2O2.Al.H2O.3H/c5-2-1-6-4(9)7-3(2)8;;;;;/h1H,(H2,6,7,8,9);;1H2;;; |
| InChIKey | PMFVPFRXYFBIGJ-UHFFFAOYSA-N |
| XLogP | -2.81 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.10 |
| LogP ≤ 5 | -2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |