C12H19FN2O2 — CID 118491878
5-fluoro-1H-pyrimidine-2,4-dione;oct-1-ene (PubChem CID 118491878) has the molecular formula C12H19FN2O2 and a molecular weight of 242.29 g/mol. Its IUPAC name is 5-fluoro-1H-pyrimidine-2,4-dione;oct-1-ene.
| Compound Name | 5-fluoro-1H-pyrimidine-2,4-dione;oct-1-ene |
|---|---|
| PubChem CID | 118491878 |
| Molecular Formula | C12H19FN2O2 |
| Molecular Weight | 242.29 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | 5-fluoro-1H-pyrimidine-2,4-dione;oct-1-ene |
| SMILES | C=CCCCCCC.O=c1[nH]cc(F)c(=O)[nH]1 |
| InChI | InChI=1S/C8H16.C4H3FN2O2/c1-3-5-7-8-6-4-2;5-2-1-6-4(9)7-3(2)8/h3H,1,4-8H2,2H3;1H,(H2,6,7,8,9) |
| InChIKey | CQRBIZUTYGRRMP-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.29 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|