C7H8ClFN2O4 — CID 174524151
2-chloro-3-methyloxiran-2-ol;5-fluoro-1H-pyrimidine-2,4-dione (PubChem CID 174524151) has the molecular formula C7H8ClFN2O4 and a molecular weight of 238.60 g/mol. Its IUPAC name is 2-chloro-3-methyloxiran-2-ol;5-fluoro-1H-pyrimidine-2,4-dione.
| Compound Name | 2-chloro-3-methyloxiran-2-ol;5-fluoro-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 174524151 |
| Molecular Formula | C7H8ClFN2O4 |
| Molecular Weight | 238.60 g/mol |
| Exact Mass | 238.02 |
| IUPAC Name | 2-chloro-3-methyloxiran-2-ol;5-fluoro-1H-pyrimidine-2,4-dione |
| SMILES | CC1OC1(O)Cl.O=c1[nH]cc(F)c(=O)[nH]1 |
| InChI | InChI=1S/C4H3FN2O2.C3H5ClO2/c5-2-1-6-4(9)7-3(2)8;1-2-3(4,5)6-2/h1H,(H2,6,7,8,9);2,5H,1H3 |
| InChIKey | SAOUYQLXTLRYNB-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 98.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.60 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|