C10H10FN3O4 — CID 174679785
ethyl 2-cyanoprop-2-enoate;5-fluoro-1H-pyrimidine-2,4-dione (PubChem CID 174679785) has the molecular formula C10H10FN3O4 and a molecular weight of 255.20 g/mol. Its IUPAC name is ethyl 2-cyanoprop-2-enoate;5-fluoro-1H-pyrimidine-2,4-dione.
| Compound Name | ethyl 2-cyanoprop-2-enoate;5-fluoro-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 174679785 |
| Molecular Formula | C10H10FN3O4 |
| Molecular Weight | 255.20 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | ethyl 2-cyanoprop-2-enoate;5-fluoro-1H-pyrimidine-2,4-dione |
| SMILES | C=C(C#N)C(=O)OCC.O=c1[nH]cc(F)c(=O)[nH]1 |
| InChI | InChI=1S/C6H7NO2.C4H3FN2O2/c1-3-9-6(8)5(2)4-7;5-2-1-6-4(9)7-3(2)8/h2-3H2,1H3;1H,(H2,6,7,8,9) |
| InChIKey | SJIVHTULZQPPEY-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.20 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|