About ethyl (E)-3-(2,4-dioxo-1H-pyrimidin-5-yl)prop-2-enoate
ethyl (E)-3-(2,4-dioxo-1H-pyrimidin-5-yl)prop-2-enoate (PubChem CID 54607042) has the molecular formula C18H20N4O8
and a molecular weight of 420.38 g/mol. Its IUPAC name is ethyl (E)-3-(2,4-dioxo-1H-pyrimidin-5-yl)prop-2-enoate.
Molecular Properties
| Compound Name | ethyl (E)-3-(2,4-dioxo-1H-pyrimidin-5-yl)prop-2-enoate |
| PubChem CID | 54607042 |
| Molecular Formula | C18H20N4O8 |
| Molecular Weight | 420.38 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | ethyl (E)-3-(2,4-dioxo-1H-pyrimidin-5-yl)prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1c[nH]c(=O)[nH]c1=O.CCOC(=O)/C=C/c1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/2C9H10N2O4/c2*1-2-15-7(12)4-3-6-5-10-9(14)11-8(6)13/h2*3-5H,2H2,1H3,(H2,10,11,13,14)/b2*4-3+ |
| InChIKey | ZNUTWLSBZWFRBE-XOMXBQTJSA-N |
| XLogP | -0.72 |
| TPSA | 184.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.38 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (E)-3-(2,4-dioxo-1H-pyrimidin-5-yl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (E)-3-(2,4-dioxo-1H-pyrimidin-5-yl)prop-2-enoate?
The IUPAC name of ethyl (E)-3-(2,4-dioxo-1H-pyrimidin-5-yl)prop-2-enoate (CID 54607042) is ethyl (E)-3-(2,4-dioxo-1H-pyrimidin-5-yl)prop-2-enoate.
What is the SMILES notation for ethyl (E)-3-(2,4-dioxo-1H-pyrimidin-5-yl)prop-2-enoate?
The canonical SMILES for ethyl (E)-3-(2,4-dioxo-1H-pyrimidin-5-yl)prop-2-enoate is CCOC(=O)/C=C/c1c[nH]c(=O)[nH]c1=O.CCOC(=O)/C=C/c1c[nH]c(=O)[nH]c1=O.
What is the InChIKey of ethyl (E)-3-(2,4-dioxo-1H-pyrimidin-5-yl)prop-2-enoate?
The InChIKey is ZNUTWLSBZWFRBE-XOMXBQTJSA-N. The full InChI is InChI=1S/2C9H10N2O4/c2*1-2-15-7(12)4-3-6-5-10-9(14)11-8(6)13/h2*3-5H,2H2,1H3,(H2,10,11,13,14)/b2*4-3+.
What are the key properties of ethyl (E)-3-(2,4-dioxo-1H-pyrimidin-5-yl)prop-2-enoate?
ethyl (E)-3-(2,4-dioxo-1H-pyrimidin-5-yl)prop-2-enoate has a molecular weight of 420.38 g/mol, XLogP of -0.72, 6 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (E)-3-(2,4-dioxo-1H-pyrimidin-5-yl)prop-2-enoate is sourced from PubChem (CID 54607042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).