C18H20N4O8 — CID 54607042
ethyl (E)-3-(2,4-dioxo-1H-pyrimidin-5-yl)prop-2-enoate (PubChem CID 54607042) has the molecular formula C18H20N4O8 and a molecular weight of 420.38 g/mol. Its IUPAC name is ethyl (E)-3-(2,4-dioxo-1H-pyrimidin-5-yl)prop-2-enoate.
| Compound Name | ethyl (E)-3-(2,4-dioxo-1H-pyrimidin-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 54607042 |
| Molecular Formula | C18H20N4O8 |
| Molecular Weight | 420.38 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | ethyl (E)-3-(2,4-dioxo-1H-pyrimidin-5-yl)prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1c[nH]c(=O)[nH]c1=O.CCOC(=O)/C=C/c1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/2C9H10N2O4/c2*1-2-15-7(12)4-3-6-5-10-9(14)11-8(6)13/h2*3-5H,2H2,1H3,(H2,10,11,13,14)/b2*4-3+ |
| InChIKey | ZNUTWLSBZWFRBE-XOMXBQTJSA-N |
| XLogP | -0.72 |
| TPSA | 184.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.38 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|