About cyclohexen-1-ylmethyl 2-cyanoprop-2-enoate
cyclohexen-1-ylmethyl 2-cyanoprop-2-enoate (PubChem CID 118412914) has the molecular formula C11H13NO2
and a molecular weight of 191.23 g/mol. Its IUPAC name is cyclohexen-1-ylmethyl 2-cyanoprop-2-enoate.
Molecular Properties
| Compound Name | cyclohexen-1-ylmethyl 2-cyanoprop-2-enoate |
| PubChem CID | 118412914 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | cyclohexen-1-ylmethyl 2-cyanoprop-2-enoate |
| SMILES | C=C(C#N)C(=O)OCC1=CCCCC1 |
| InChI | InChI=1S/C11H13NO2/c1-9(7-12)11(13)14-8-10-5-3-2-4-6-10/h5H,1-4,6,8H2 |
| InChIKey | JLJYGMNGLFOQOB-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze cyclohexen-1-ylmethyl 2-cyanoprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexen-1-ylmethyl 2-cyanoprop-2-enoate?
The IUPAC name of cyclohexen-1-ylmethyl 2-cyanoprop-2-enoate (CID 118412914) is cyclohexen-1-ylmethyl 2-cyanoprop-2-enoate.
What is the SMILES notation for cyclohexen-1-ylmethyl 2-cyanoprop-2-enoate?
The canonical SMILES for cyclohexen-1-ylmethyl 2-cyanoprop-2-enoate is C=C(C#N)C(=O)OCC1=CCCCC1.
What is the InChIKey of cyclohexen-1-ylmethyl 2-cyanoprop-2-enoate?
The InChIKey is JLJYGMNGLFOQOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO2/c1-9(7-12)11(13)14-8-10-5-3-2-4-6-10/h5H,1-4,6,8H2.
What are the key properties of cyclohexen-1-ylmethyl 2-cyanoprop-2-enoate?
cyclohexen-1-ylmethyl 2-cyanoprop-2-enoate has a molecular weight of 191.23 g/mol, XLogP of 2.11, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexen-1-ylmethyl 2-cyanoprop-2-enoate is sourced from PubChem (CID 118412914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).