About cyclopenten-1-ylmethyl 2-hydroxybenzoate
cyclopenten-1-ylmethyl 2-hydroxybenzoate (PubChem CID 154511016) has the molecular formula C13H14O3
and a molecular weight of 218.25 g/mol. Its IUPAC name is cyclopenten-1-ylmethyl 2-hydroxybenzoate.
Molecular Properties
| Compound Name | cyclopenten-1-ylmethyl 2-hydroxybenzoate |
| PubChem CID | 154511016 |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | cyclopenten-1-ylmethyl 2-hydroxybenzoate |
| SMILES | O=C(OCC1=CCCC1)c1ccccc1O |
| InChI | InChI=1S/C13H14O3/c14-12-8-4-3-7-11(12)13(15)16-9-10-5-1-2-6-10/h3-5,7-8,14H,1-2,6,9H2 |
| InChIKey | SSCMCPHEXPHLMX-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cyclopenten-1-ylmethyl 2-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenten-1-ylmethyl 2-hydroxybenzoate?
The IUPAC name of cyclopenten-1-ylmethyl 2-hydroxybenzoate (CID 154511016) is cyclopenten-1-ylmethyl 2-hydroxybenzoate.
What is the SMILES notation for cyclopenten-1-ylmethyl 2-hydroxybenzoate?
The canonical SMILES for cyclopenten-1-ylmethyl 2-hydroxybenzoate is O=C(OCC1=CCCC1)c1ccccc1O.
What is the InChIKey of cyclopenten-1-ylmethyl 2-hydroxybenzoate?
The InChIKey is SSCMCPHEXPHLMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14O3/c14-12-8-4-3-7-11(12)13(15)16-9-10-5-1-2-6-10/h3-5,7-8,14H,1-2,6,9H2.
What are the key properties of cyclopenten-1-ylmethyl 2-hydroxybenzoate?
cyclopenten-1-ylmethyl 2-hydroxybenzoate has a molecular weight of 218.25 g/mol, XLogP of 2.66, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenten-1-ylmethyl 2-hydroxybenzoate is sourced from PubChem (CID 154511016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).