C15H15O4- — CID 18324577
4-(cyclohexen-1-ylmethoxycarbonyl)benzoate (PubChem CID 18324577) has the molecular formula C15H15O4- and a molecular weight of 259.28 g/mol. Its IUPAC name is 4-(cyclohexen-1-ylmethoxycarbonyl)benzoate.
| Compound Name | 4-(cyclohexen-1-ylmethoxycarbonyl)benzoate |
|---|---|
| PubChem CID | 18324577 |
| Molecular Formula | C15H15O4- |
| Molecular Weight | 259.28 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 4-(cyclohexen-1-ylmethoxycarbonyl)benzoate |
| SMILES | O=C([O-])c1ccc(C(=O)OCC2=CCCCC2)cc1 |
| InChI | InChI=1S/C15H16O4/c16-14(17)12-6-8-13(9-7-12)15(18)19-10-11-4-2-1-3-5-11/h4,6-9H,1-3,5,10H2,(H,16,17)/p-1 |
| InChIKey | AVJUBJFFNFZXJT-UHFFFAOYSA-M |
| XLogP | 1.71 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.28 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|