C20H27NO4 — CID 7471627
ethyl 4-[(2R)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl]oxybenzoate (PubChem CID 7471627) has the molecular formula C20H27NO4 and a molecular weight of 345.44 g/mol. Its IUPAC name is ethyl 4-[(2R)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl]oxybenzoate.
| Compound Name | ethyl 4-[(2R)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl]oxybenzoate |
|---|---|
| PubChem CID | 7471627 |
| Molecular Formula | C20H27NO4 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | ethyl 4-[(2R)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl]oxybenzoate |
| SMILES | CCOC(=O)c1ccc(O[C@H](C)C(=O)NCCC2=CCCCC2)cc1 |
| InChI | InChI=1S/C20H27NO4/c1-3-24-20(23)17-9-11-18(12-10-17)25-15(2)19(22)21-14-13-16-7-5-4-6-8-16/h7,9-12,15H,3-6,8,13-14H2,1-2H3,(H,21,22)/t15-/m1/s1 |
| InChIKey | PIUSBBPRQGPKTI-OAHLLOKOSA-N |
| XLogP | 3.64 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|