C16H16O3 — CID 175168721
(2,3-dimethylphenyl)methyl 2-hydroxybenzoate (PubChem CID 175168721) has the molecular formula C16H16O3 and a molecular weight of 256.30 g/mol. Its IUPAC name is (2,3-dimethylphenyl)methyl 2-hydroxybenzoate.
| Compound Name | (2,3-dimethylphenyl)methyl 2-hydroxybenzoate |
|---|---|
| PubChem CID | 175168721 |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | (2,3-dimethylphenyl)methyl 2-hydroxybenzoate |
| SMILES | Cc1cccc(COC(=O)c2ccccc2O)c1C |
| InChI | InChI=1S/C16H16O3/c1-11-6-5-7-13(12(11)2)10-19-16(18)14-8-3-4-9-15(14)17/h3-9,17H,10H2,1-2H3 |
| InChIKey | SDWQIPWRCMICSG-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |