About (2,3-dimethylphenyl)methyl butanoate
(2,3-dimethylphenyl)methyl butanoate (PubChem CID 71330458) has the molecular formula C13H18O2
and a molecular weight of 206.28 g/mol. Its IUPAC name is (2,3-dimethylphenyl)methyl butanoate.
Molecular Properties
| Compound Name | (2,3-dimethylphenyl)methyl butanoate |
| PubChem CID | 71330458 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | (2,3-dimethylphenyl)methyl butanoate |
| SMILES | CCCC(=O)OCc1cccc(C)c1C |
| InChI | InChI=1S/C13H18O2/c1-4-6-13(14)15-9-12-8-5-7-10(2)11(12)3/h5,7-8H,4,6,9H2,1-3H3 |
| InChIKey | GNVFRFUNHJPTAY-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2,3-dimethylphenyl)methyl butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,3-dimethylphenyl)methyl butanoate?
The IUPAC name of (2,3-dimethylphenyl)methyl butanoate (CID 71330458) is (2,3-dimethylphenyl)methyl butanoate.
What is the SMILES notation for (2,3-dimethylphenyl)methyl butanoate?
The canonical SMILES for (2,3-dimethylphenyl)methyl butanoate is CCCC(=O)OCc1cccc(C)c1C.
What is the InChIKey of (2,3-dimethylphenyl)methyl butanoate?
The InChIKey is GNVFRFUNHJPTAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O2/c1-4-6-13(14)15-9-12-8-5-7-10(2)11(12)3/h5,7-8H,4,6,9H2,1-3H3.
What are the key properties of (2,3-dimethylphenyl)methyl butanoate?
(2,3-dimethylphenyl)methyl butanoate has a molecular weight of 206.28 g/mol, XLogP of 3.15, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3-dimethylphenyl)methyl butanoate is sourced from PubChem (CID 71330458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).