C13H18O2 — CID 71330458
(2,3-dimethylphenyl)methyl butanoate (PubChem CID 71330458) has the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. Its IUPAC name is (2,3-dimethylphenyl)methyl butanoate.
| Compound Name | (2,3-dimethylphenyl)methyl butanoate |
|---|---|
| PubChem CID | 71330458 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | (2,3-dimethylphenyl)methyl butanoate |
| SMILES | CCCC(=O)OCc1cccc(C)c1C |
| InChI | InChI=1S/C13H18O2/c1-4-6-13(14)15-9-12-8-5-7-10(2)11(12)3/h5,7-8H,4,6,9H2,1-3H3 |
| InChIKey | GNVFRFUNHJPTAY-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |