C10H12FN3O3 — CID 173137049
5-fluoro-1H-pyrimidine-2,4-dione;hexa-2,4-dienamide (PubChem CID 173137049) has the molecular formula C10H12FN3O3 and a molecular weight of 241.22 g/mol. Its IUPAC name is 5-fluoro-1H-pyrimidine-2,4-dione;hexa-2,4-dienamide.
| Compound Name | 5-fluoro-1H-pyrimidine-2,4-dione;hexa-2,4-dienamide |
|---|---|
| PubChem CID | 173137049 |
| Molecular Formula | C10H12FN3O3 |
| Molecular Weight | 241.22 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 5-fluoro-1H-pyrimidine-2,4-dione;hexa-2,4-dienamide |
| SMILES | CC=CC=CC(N)=O.O=c1[nH]cc(F)c(=O)[nH]1 |
| InChI | InChI=1S/C6H9NO.C4H3FN2O2/c1-2-3-4-5-6(7)8;5-2-1-6-4(9)7-3(2)8/h2-5H,1H3,(H2,7,8);1H,(H2,6,7,8,9) |
| InChIKey | GICPYDSNHICPFA-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 108.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.22 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|