About 5-fluoro-1H-pyrimidine-2,4-dione;hexa-2,4-dienamide
5-fluoro-1H-pyrimidine-2,4-dione;hexa-2,4-dienamide (PubChem CID 173137049) has the molecular formula C10H12FN3O3
and a molecular weight of 241.22 g/mol. Its IUPAC name is 5-fluoro-1H-pyrimidine-2,4-dione;hexa-2,4-dienamide.
Molecular Properties
| Compound Name | 5-fluoro-1H-pyrimidine-2,4-dione;hexa-2,4-dienamide |
| PubChem CID | 173137049 |
| Molecular Formula | C10H12FN3O3 |
| Molecular Weight | 241.22 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 5-fluoro-1H-pyrimidine-2,4-dione;hexa-2,4-dienamide |
| SMILES | CC=CC=CC(N)=O.O=c1[nH]cc(F)c(=O)[nH]1 |
| InChI | InChI=1S/C6H9NO.C4H3FN2O2/c1-2-3-4-5-6(7)8;5-2-1-6-4(9)7-3(2)8/h2-5H,1H3,(H2,7,8);1H,(H2,6,7,8,9) |
| InChIKey | GICPYDSNHICPFA-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 108.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.22 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-1H-pyrimidine-2,4-dione;hexa-2,4-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-1H-pyrimidine-2,4-dione;hexa-2,4-dienamide?
The IUPAC name of 5-fluoro-1H-pyrimidine-2,4-dione;hexa-2,4-dienamide (CID 173137049) is 5-fluoro-1H-pyrimidine-2,4-dione;hexa-2,4-dienamide.
What is the SMILES notation for 5-fluoro-1H-pyrimidine-2,4-dione;hexa-2,4-dienamide?
The canonical SMILES for 5-fluoro-1H-pyrimidine-2,4-dione;hexa-2,4-dienamide is CC=CC=CC(N)=O.O=c1[nH]cc(F)c(=O)[nH]1.
What is the InChIKey of 5-fluoro-1H-pyrimidine-2,4-dione;hexa-2,4-dienamide?
The InChIKey is GICPYDSNHICPFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO.C4H3FN2O2/c1-2-3-4-5-6(7)8;5-2-1-6-4(9)7-3(2)8/h2-5H,1H3,(H2,7,8);1H,(H2,6,7,8,9).
What are the key properties of 5-fluoro-1H-pyrimidine-2,4-dione;hexa-2,4-dienamide?
5-fluoro-1H-pyrimidine-2,4-dione;hexa-2,4-dienamide has a molecular weight of 241.22 g/mol, XLogP of -0.19, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-1H-pyrimidine-2,4-dione;hexa-2,4-dienamide is sourced from PubChem (CID 173137049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).