C8H8N2O3 — CID 92527239
5-[(Z)-3-oxobut-1-enyl]-1H-pyrimidine-2,4-dione (PubChem CID 92527239) has the molecular formula C8H8N2O3 and a molecular weight of 180.16 g/mol. Its IUPAC name is 5-[(Z)-3-oxobut-1-enyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 5-[(Z)-3-oxobut-1-enyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 92527239 |
| Molecular Formula | C8H8N2O3 |
| Molecular Weight | 180.16 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | 5-[(Z)-3-oxobut-1-enyl]-1H-pyrimidine-2,4-dione |
| SMILES | CC(=O)/C=C\c1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C8H8N2O3/c1-5(11)2-3-6-4-9-8(13)10-7(6)12/h2-4H,1H3,(H2,9,10,12,13)/b3-2- |
| InChIKey | ROAAEOJUCDTGGM-IHWYPQMZSA-N |
| XLogP | -0.33 |
| TPSA | 82.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.16 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|