C8H9N5O2 — CID 170484938
5-(4-azidobut-1-enyl)-1H-pyrimidine-2,4-dione (PubChem CID 170484938) has the molecular formula C8H9N5O2 and a molecular weight of 207.19 g/mol. Its IUPAC name is 5-(4-azidobut-1-enyl)-1H-pyrimidine-2,4-dione.
| Compound Name | 5-(4-azidobut-1-enyl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 170484938 |
| Molecular Formula | C8H9N5O2 |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | 5-(4-azidobut-1-enyl)-1H-pyrimidine-2,4-dione |
| SMILES | [N-]=[N+]=NCCC=Cc1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C8H9N5O2/c9-13-11-4-2-1-3-6-5-10-8(15)12-7(6)14/h1,3,5H,2,4H2,(H2,10,12,14,15) |
| InChIKey | UAOPGNZUMZJXCU-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|