C5H6N4O2 — CID 137221150
5-methanehydrazonoyl-1H-pyrimidine-2,4-dione (PubChem CID 137221150) has the molecular formula C5H6N4O2 and a molecular weight of 154.13 g/mol. Its IUPAC name is 5-methanehydrazonoyl-1H-pyrimidine-2,4-dione.
| Compound Name | 5-methanehydrazonoyl-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 137221150 |
| Molecular Formula | C5H6N4O2 |
| Molecular Weight | 154.13 g/mol |
| Exact Mass | 154.05 |
| IUPAC Name | 5-methanehydrazonoyl-1H-pyrimidine-2,4-dione |
| SMILES | NN=Cc1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C5H6N4O2/c6-8-2-3-1-7-5(11)9-4(3)10/h1-2H,6H2,(H2,7,9,10,11) |
| InChIKey | LUJGASZYPCMRIB-UHFFFAOYSA-N |
| XLogP | -1.64 |
| TPSA | 104.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.13 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|