C10H6N4O4 — CID 10658057
5-[2-(2,4-dioxo-1H-pyrimidin-5-yl)ethynyl]-1H-pyrimidine-2,4-dione (PubChem CID 10658057) has the molecular formula C10H6N4O4 and a molecular weight of 246.18 g/mol. Its IUPAC name is 5-[2-(2,4-dioxo-1H-pyrimidin-5-yl)ethynyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 5-[2-(2,4-dioxo-1H-pyrimidin-5-yl)ethynyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10658057 |
| Molecular Formula | C10H6N4O4 |
| Molecular Weight | 246.18 g/mol |
| Exact Mass | 246.04 |
| IUPAC Name | 5-[2-(2,4-dioxo-1H-pyrimidin-5-yl)ethynyl]-1H-pyrimidine-2,4-dione |
| SMILES | O=c1[nH]cc(C#Cc2c[nH]c(=O)[nH]c2=O)c(=O)[nH]1 |
| InChI | InChI=1S/C10H6N4O4/c15-7-5(3-11-9(17)13-7)1-2-6-4-12-10(18)14-8(6)16/h3-4H,(H2,11,13,15,17)(H2,12,14,16,18) |
| InChIKey | XHXSGQRDYJJRLE-UHFFFAOYSA-N |
| XLogP | -2.16 |
| TPSA | 131.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.18 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|