C17H18N2O2 — CID 46915229
5-[2-(4-pentylphenyl)ethynyl]-1H-pyrimidine-2,4-dione (PubChem CID 46915229) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is 5-[2-(4-pentylphenyl)ethynyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 5-[2-(4-pentylphenyl)ethynyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 46915229 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 5-[2-(4-pentylphenyl)ethynyl]-1H-pyrimidine-2,4-dione |
| SMILES | CCCCCc1ccc(C#Cc2c[nH]c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C17H18N2O2/c1-2-3-4-5-13-6-8-14(9-7-13)10-11-15-12-18-17(21)19-16(15)20/h6-9,12H,2-5H2,1H3,(H2,18,19,20,21) |
| InChIKey | JDDUKWJGFGDBAL-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|