C6H5IN2O2 — CID 150870731
5-(2-(131I)iodoethenyl)-1H-pyrimidine-2,4-dione (PubChem CID 150870731) has the molecular formula C6H5IN2O2 and a molecular weight of 268.02 g/mol. Its IUPAC name is 5-(2-(131I)iodoethenyl)-1H-pyrimidine-2,4-dione.
| Compound Name | 5-(2-(131I)iodoethenyl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 150870731 |
| Molecular Formula | C6H5IN2O2 |
| Molecular Weight | 268.02 g/mol |
| Exact Mass | 267.94 |
| IUPAC Name | 5-(2-(131I)iodoethenyl)-1H-pyrimidine-2,4-dione |
| SMILES | O=c1[nH]cc(C=C[131I])c(=O)[nH]1 |
| InChI | InChI=1S/C6H5IN2O2/c7-2-1-4-3-8-6(11)9-5(4)10/h1-3H,(H2,8,9,10,11)/i7+4 |
| InChIKey | KTZDXHJATZVCLY-DMXXYFNZSA-N |
| XLogP | 0.47 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.02 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|